C24H25NO4S — CID 68691582
2-[2-[3-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68691582) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 2-[2-[3-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 2-[2-[3-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68691582 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[2-[3-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2cccc(CCc3ccccc3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H25NO4S/c1-17(2)19-12-14-22(15-13-19)30(28,29)25-21-8-5-6-18(16-21)10-11-20-7-3-4-9-23(20)24(26)27/h3-9,12-17,25H,10-11H2,1-2H3,(H,26,27) |
| InChIKey | PECRPOZKZYGBHJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |