C21H18ClNO4S — CID 68688369
2-[2-[3-[(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68688369) has the molecular formula C21H18ClNO4S and a molecular weight of 415.90 g/mol. Its IUPAC name is 2-[2-[3-[(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 2-[2-[3-[(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688369 |
| Molecular Formula | C21H18ClNO4S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-[2-[3-[(4-chlorophenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCc1cccc(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H18ClNO4S/c22-17-10-12-19(13-11-17)28(26,27)23-18-6-3-4-15(14-18)8-9-16-5-1-2-7-20(16)21(24)25/h1-7,10-14,23H,8-9H2,(H,24,25) |
| InChIKey | NWJBFBLDFOLNFC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |