C47H48N2O9S2 — CID 158194945
2-[2-[3-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid;2-[2-[3-[(3-methoxyphenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 158194945) has the molecular formula C47H48N2O9S2 and a molecular weight of 849.04 g/mol. Its IUPAC name is 2-[2-[3-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid;2-[2-[3-[(3-methoxyphenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 2-[2-[3-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid;2-[2-[3-[(3-methoxyphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 158194945 |
| Molecular Formula | C47H48N2O9S2 |
| Molecular Weight | 849.04 g/mol |
| Exact Mass | 848.28 |
| IUPAC Name | 2-[2-[3-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid;2-[2-[3-[(3-methoxyphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cccc(CCc3ccccc3C(=O)O)c2)cc1.COc1cccc(S(=O)(=O)Nc2cccc(CCc3ccccc3C(=O)O)c2)c1 |
| InChI | InChI=1S/C25H27NO4S.C22H21NO5S/c1-2-3-7-19-13-16-23(17-14-19)31(29,30)26-22-10-6-8-20(18-22)12-15-21-9-4-5-11-24(21)25(27)28;1-28-19-9-5-10-20(15-19)29(26,27)23-18-8-4-6-16(14-18)12-13-17-7-2-3-11-21(17)22(24)25/h4-6,8-11,13-14,16-18,26H,2-3,7,12,15H2,1H3,(H,27,28);2-11,14-15,23H,12-13H2,1H3,(H,24,25) |
| InChIKey | GAFOFBAZAVIGGV-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.04 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |