C30H30N2O8S2 — CID 45274237
2-[(4-butylphenyl)sulfonylamino]-5-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]benzoic acid (PubChem CID 45274237) has the molecular formula C30H30N2O8S2 and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-[(4-butylphenyl)sulfonylamino]-5-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[(4-butylphenyl)sulfonylamino]-5-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 45274237 |
| Molecular Formula | C30H30N2O8S2 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 2-[(4-butylphenyl)sulfonylamino]-5-[[4-(2-methoxyphenoxy)phenyl]sulfonylamino]benzoic acid |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccc(NS(=O)(=O)c3ccc(Oc4ccccc4OC)cc3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H30N2O8S2/c1-3-4-7-21-10-15-24(16-11-21)42(37,38)32-27-19-12-22(20-26(27)30(33)34)31-41(35,36)25-17-13-23(14-18-25)40-29-9-6-5-8-28(29)39-2/h5-6,8-20,31-32H,3-4,7H2,1-2H3,(H,33,34) |
| InChIKey | LUUDYWBRNNZRSJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|