C21H27NO6S — CID 84552363
2-[(4-hexylphenyl)sulfonylamino]-4,5-dimethoxybenzoic acid (PubChem CID 84552363) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[(4-hexylphenyl)sulfonylamino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[(4-hexylphenyl)sulfonylamino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 84552363 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-[(4-hexylphenyl)sulfonylamino]-4,5-dimethoxybenzoic acid |
| SMILES | CCCCCCc1ccc(S(=O)(=O)Nc2cc(OC)c(OC)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H27NO6S/c1-4-5-6-7-8-15-9-11-16(12-10-15)29(25,26)22-18-14-20(28-3)19(27-2)13-17(18)21(23)24/h9-14,22H,4-8H2,1-3H3,(H,23,24) |
| InChIKey | AQKUWPATHGGNIO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|