C19H17NO6S — CID 45478490
3-[(3,4-dimethoxyphenyl)sulfonylamino]naphthalene-2-carboxylic acid (PubChem CID 45478490) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfonylamino]naphthalene-2-carboxylic acid.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 45478490 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]naphthalene-2-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc3ccccc3cc2C(=O)O)cc1OC |
| InChI | InChI=1S/C19H17NO6S/c1-25-17-8-7-14(11-18(17)26-2)27(23,24)20-16-10-13-6-4-3-5-12(13)9-15(16)19(21)22/h3-11,20H,1-2H3,(H,21,22) |
| InChIKey | ASOHYLLHCGJSPT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |