C14H12FNO5S — CID 56812258
5-[(2-fluorophenyl)sulfamoyl]-2-methoxybenzoic acid (PubChem CID 56812258) has the molecular formula C14H12FNO5S and a molecular weight of 325.32 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)sulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(2-fluorophenyl)sulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 56812258 |
| Molecular Formula | C14H12FNO5S |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 5-[(2-fluorophenyl)sulfamoyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2F)cc1C(=O)O |
| InChI | InChI=1S/C14H12FNO5S/c1-21-13-7-6-9(8-10(13)14(17)18)22(19,20)16-12-5-3-2-4-11(12)15/h2-8,16H,1H3,(H,17,18) |
| InChIKey | PXLHCKJPVOCMFI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |