C14H12F5NO5S2 — CID 86786581
2-methoxy-5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 86786581) has the molecular formula C14H12F5NO5S2 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-methoxy-5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-methoxy-5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 86786581 |
| Molecular Formula | C14H12F5NO5S2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 2-methoxy-5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(S(F)(F)(F)(F)F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C14H12F5NO5S2/c1-25-13-7-4-10(8-12(13)14(21)22)26(23,24)20-9-2-5-11(6-3-9)27(15,16,17,18)19/h2-8,20H,1H3,(H,21,22) |
| InChIKey | ILPNTCHRMXARQZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |