C18H21NO8S — CID 100820211
5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfamoyl]-2-methoxybenzoic acid (PubChem CID 100820211) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is 5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 100820211 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 5-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfamoyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(OCCOCCO)cc2)cc1C(=O)O |
| InChI | InChI=1S/C18H21NO8S/c1-25-17-7-6-15(12-16(17)18(21)22)28(23,24)19-13-2-4-14(5-3-13)27-11-10-26-9-8-20/h2-7,12,19-20H,8-11H2,1H3,(H,21,22) |
| InChIKey | NHQGAQBFJWZUDB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|