C20H17NO8S2 — CID 45475412
2-(benzenesulfonyloxy)-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid (PubChem CID 45475412) has the molecular formula C20H17NO8S2 and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-(benzenesulfonyloxy)-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2-(benzenesulfonyloxy)-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 45475412 |
| Molecular Formula | C20H17NO8S2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-(benzenesulfonyloxy)-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OS(=O)(=O)c3ccccc3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H17NO8S2/c1-28-15-9-7-14(8-10-15)21-30(24,25)17-11-12-19(18(13-17)20(22)23)29-31(26,27)16-5-3-2-4-6-16/h2-13,21H,1H3,(H,22,23) |
| InChIKey | QDPJFKZKKQIGLD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|