C20H18N2O7S2 — CID 2414183
3-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoic acid (PubChem CID 2414183) has the molecular formula C20H18N2O7S2 and a molecular weight of 462.51 g/mol. Its IUPAC name is 3-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 2414183 |
| Molecular Formula | C20H18N2O7S2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 3-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3cccc(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O7S2/c1-29-17-9-5-15(6-10-17)21-30(25,26)18-11-7-16(8-12-18)22-31(27,28)19-4-2-3-14(13-19)20(23)24/h2-13,21-22H,1H3,(H,23,24) |
| InChIKey | CWAGXDACWXJOBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |