C22H18F3N3O5S — CID 46652595
N-(4-methoxyphenyl)-3-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 46652595) has the molecular formula C22H18F3N3O5S and a molecular weight of 493.46 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-3-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46652595 |
| Molecular Formula | C22H18F3N3O5S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-(4-methoxyphenyl)-3-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C22H18F3N3O5S/c1-33-18-11-9-17(10-12-18)28-34(31,32)19-4-2-3-15(13-19)21(30)27-26-20(29)14-5-7-16(8-6-14)22(23,24)25/h2-13,28H,1H3,(H,26,29)(H,27,30) |
| InChIKey | XCXSSXPPVSIDHC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|