C21H18F3N3O4S — CID 55529114
N-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide (PubChem CID 55529114) has the molecular formula C21H18F3N3O4S and a molecular weight of 465.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55529114 |
| Molecular Formula | C21H18F3N3O4S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-(4-methoxyphenyl)-3-[[3-(trifluoromethyl)anilino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C21H18F3N3O4S/c1-31-18-10-8-16(9-11-18)27-32(29,30)19-7-2-4-14(12-19)20(28)26-25-17-6-3-5-15(13-17)21(22,23)24/h2-13,25,27H,1H3,(H,26,28) |
| InChIKey | YCAXMYJHXAGBDN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|