C22H20F3N3O7S2 — CID 24684528
3-[[(2,5-dimethoxyphenyl)sulfonylamino]carbamoyl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 24684528) has the molecular formula C22H20F3N3O7S2 and a molecular weight of 559.54 g/mol. Its IUPAC name is 3-[[(2,5-dimethoxyphenyl)sulfonylamino]carbamoyl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3-[[(2,5-dimethoxyphenyl)sulfonylamino]carbamoyl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24684528 |
| Molecular Formula | C22H20F3N3O7S2 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 3-[[(2,5-dimethoxyphenyl)sulfonylamino]carbamoyl]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NNC(=O)c2cccc(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C22H20F3N3O7S2/c1-34-17-9-10-19(35-2)20(13-17)37(32,33)28-26-21(29)14-5-3-8-18(11-14)36(30,31)27-16-7-4-6-15(12-16)22(23,24)25/h3-13,27-28H,1-2H3,(H,26,29) |
| InChIKey | AUOOZOYLYXBKKI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|