C28H22F3NO5S — CID 129231611
2-methoxy-5-[4-(4-methylbenzoyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 129231611) has the molecular formula C28H22F3NO5S and a molecular weight of 541.55 g/mol. Its IUPAC name is 2-methoxy-5-[4-(4-methylbenzoyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-[4-(4-methylbenzoyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129231611 |
| Molecular Formula | C28H22F3NO5S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 2-methoxy-5-[4-(4-methylbenzoyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(Oc2ccc(C(=O)c3ccc(C)cc3)cc2)cc1S(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H22F3NO5S/c1-18-6-8-19(9-7-18)27(33)20-10-12-23(13-11-20)37-24-14-15-25(36-2)26(17-24)38(34,35)32-22-5-3-4-21(16-22)28(29,30)31/h3-17,32H,1-2H3 |
| InChIKey | UWIOXCWCUQWBEA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |