C21H17F2N3O5S — CID 46652429
3-[[(3,5-difluorobenzoyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 46652429) has the molecular formula C21H17F2N3O5S and a molecular weight of 461.45 g/mol. Its IUPAC name is 3-[[(3,5-difluorobenzoyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[[(3,5-difluorobenzoyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46652429 |
| Molecular Formula | C21H17F2N3O5S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 3-[[(3,5-difluorobenzoyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)c3cc(F)cc(F)c3)c2)cc1 |
| InChI | InChI=1S/C21H17F2N3O5S/c1-31-18-7-5-17(6-8-18)26-32(29,30)19-4-2-3-13(11-19)20(27)24-25-21(28)14-9-15(22)12-16(23)10-14/h2-12,26H,1H3,(H,24,27)(H,25,28) |
| InChIKey | JPVFJXHTOJYKSH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|