C24H20FN3O6S — CID 46652482
3-[[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 46652482) has the molecular formula C24H20FN3O6S and a molecular weight of 497.50 g/mol. Its IUPAC name is 3-[[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46652482 |
| Molecular Formula | C24H20FN3O6S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 3-[[(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)c3oc4c(F)cccc4c3C)c2)cc1 |
| InChI | InChI=1S/C24H20FN3O6S/c1-14-19-7-4-8-20(25)22(19)34-21(14)24(30)27-26-23(29)15-5-3-6-18(13-15)35(31,32)28-16-9-11-17(33-2)12-10-16/h3-13,28H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | USYWXOZGIZBQJV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|