C20H17ClN4O5S — CID 46638038
3-[[(2-chloropyridine-4-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 46638038) has the molecular formula C20H17ClN4O5S and a molecular weight of 460.90 g/mol. Its IUPAC name is 3-[[(2-chloropyridine-4-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[[(2-chloropyridine-4-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46638038 |
| Molecular Formula | C20H17ClN4O5S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 3-[[(2-chloropyridine-4-carbonyl)amino]carbamoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)c3ccnc(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C20H17ClN4O5S/c1-30-16-7-5-15(6-8-16)25-31(28,29)17-4-2-3-13(11-17)19(26)23-24-20(27)14-9-10-22-18(21)12-14/h2-12,25H,1H3,(H,23,26)(H,24,27) |
| InChIKey | KDUKIEYFPKRSFY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|