C24H23N3O6S — CID 30828589
N-(4-methoxyphenyl)-3-[[(4-prop-2-enoxybenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 30828589) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-[[(4-prop-2-enoxybenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-3-[[(4-prop-2-enoxybenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30828589 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-(4-methoxyphenyl)-3-[[(4-prop-2-enoxybenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)c2cccc(S(=O)(=O)Nc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H23N3O6S/c1-3-15-33-21-11-7-17(8-12-21)23(28)25-26-24(29)18-5-4-6-22(16-18)34(30,31)27-19-9-13-20(32-2)14-10-19/h3-14,16,27H,1,15H2,2H3,(H,25,28)(H,26,29) |
| InChIKey | RFKFAJQQZBPUEV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|