C17H19ClN4O5S — CID 2327322
1-(2-chloroethyl)-3-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]amino]urea (PubChem CID 2327322) has the molecular formula C17H19ClN4O5S and a molecular weight of 426.88 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]amino]urea.
| Compound Name | 1-(2-chloroethyl)-3-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]amino]urea |
|---|---|
| PubChem CID | 2327322 |
| Molecular Formula | C17H19ClN4O5S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 1-(2-chloroethyl)-3-[[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]amino]urea |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)NCCCl)c2)cc1 |
| InChI | InChI=1S/C17H19ClN4O5S/c1-27-14-7-5-13(6-8-14)22-28(25,26)15-4-2-3-12(11-15)16(23)20-21-17(24)19-10-9-18/h2-8,11,22H,9-10H2,1H3,(H,20,23)(H2,19,21,24) |
| InChIKey | SOOKCYBMDGMVHZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|