C25H26N4O8S — CID 42910311
3,5-dimethoxy-N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 42910311) has the molecular formula C25H26N4O8S and a molecular weight of 542.57 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42910311 |
| Molecular Formula | C25H26N4O8S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 3,5-dimethoxy-N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)CNC(=O)c3cc(OC)cc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C25H26N4O8S/c1-35-19-9-7-18(8-10-19)29-38(33,34)22-6-4-5-16(13-22)25(32)28-27-23(30)15-26-24(31)17-11-20(36-2)14-21(12-17)37-3/h4-14,29H,15H2,1-3H3,(H,26,31)(H,27,30)(H,28,32) |
| InChIKey | ZCGQUHHTDNWRMR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|