C24H22N4O8S — CID 4851184
N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4851184) has the molecular formula C24H22N4O8S and a molecular weight of 526.53 g/mol. Its IUPAC name is N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4851184 |
| Molecular Formula | C24H22N4O8S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-[2-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)CNC(=O)c3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C24H22N4O8S/c1-34-18-8-6-17(7-9-18)28-37(32,33)19-4-2-3-15(11-19)24(31)27-26-22(29)13-25-23(30)16-5-10-20-21(12-16)36-14-35-20/h2-12,28H,13-14H2,1H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | WZMODINTVLVSCF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|