C19H22N4O6S2 — CID 30822325
2-[3-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-3-oxopropyl]sulfanylacetamide (PubChem CID 30822325) has the molecular formula C19H22N4O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[3-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-3-oxopropyl]sulfanylacetamide.
| Compound Name | 2-[3-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-3-oxopropyl]sulfanylacetamide |
|---|---|
| PubChem CID | 30822325 |
| Molecular Formula | C19H22N4O6S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-[3-[2-[3-[(4-methoxyphenyl)sulfamoyl]benzoyl]hydrazinyl]-3-oxopropyl]sulfanylacetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)CCSCC(N)=O)c2)cc1 |
| InChI | InChI=1S/C19H22N4O6S2/c1-29-15-7-5-14(6-8-15)23-31(27,28)16-4-2-3-13(11-16)19(26)22-21-18(25)9-10-30-12-17(20)24/h2-8,11,23H,9-10,12H2,1H3,(H2,20,24)(H,21,25)(H,22,26) |
| InChIKey | LGGCBMNUXFJZQX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|