C15H16N2O5S — CID 17421680
N-methoxy-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 17421680) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-methoxy-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-methoxy-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 17421680 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-methoxy-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | CONC(=O)c1cccc(S(=O)(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C15H16N2O5S/c1-21-13-8-6-12(7-9-13)17-23(19,20)14-5-3-4-11(10-14)15(18)16-22-2/h3-10,17H,1-2H3,(H,16,18) |
| InChIKey | IZABPBYFNZCGFM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|