C19H21N3O6S — CID 9163346
3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide (PubChem CID 9163346) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 9163346 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[2-oxo-2-(propylamino)ethyl]benzamide |
| SMILES | CCCNC(=O)CNC(=O)c1cccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H21N3O6S/c1-2-8-20-18(23)11-21-19(24)13-4-3-5-15(9-13)29(25,26)22-14-6-7-16-17(10-14)28-12-27-16/h3-7,9-10,22H,2,8,11-12H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | GWFVLOOXWBKNKN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |