C21H21F3N2O5S — CID 42936334
3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[3-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 42936334) has the molecular formula C21H21F3N2O5S and a molecular weight of 470.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[3-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[3-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 42936334 |
| Molecular Formula | C21H21F3N2O5S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylsulfamoyl)-N-[3-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCCC(C(F)(F)F)C1)c1cccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C21H21F3N2O5S/c22-21(23,24)14-4-2-5-15(10-14)25-20(27)13-3-1-6-17(9-13)32(28,29)26-16-7-8-18-19(11-16)31-12-30-18/h1,3,6-9,11,14-15,26H,2,4-5,10,12H2,(H,25,27) |
| InChIKey | NHDOMRRFTCTDKM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |