C17H23F3N2O3S — CID 25348383
3-(propylsulfonylamino)-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 25348383) has the molecular formula C17H23F3N2O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 3-(propylsulfonylamino)-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 3-(propylsulfonylamino)-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 25348383 |
| Molecular Formula | C17H23F3N2O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-(propylsulfonylamino)-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CCCS(=O)(=O)Nc1cccc(C(=O)N[C@@H]2CCC[C@@H](C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C17H23F3N2O3S/c1-2-9-26(24,25)22-15-8-3-5-12(10-15)16(23)21-14-7-4-6-13(11-14)17(18,19)20/h3,5,8,10,13-14,22H,2,4,6-7,9,11H2,1H3,(H,21,23)/t13-,14-/m1/s1 |
| InChIKey | AAWTYUXGDOVVCH-ZIAGYGMSSA-N |
| XLogP | 3.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |