C16H21F3N2O2 — CID 99625911
N-(2-hydroxyethyl)-3-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]benzamide (PubChem CID 99625911) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]benzamide.
| Compound Name | N-(2-hydroxyethyl)-3-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]benzamide |
|---|---|
| PubChem CID | 99625911 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(2-hydroxyethyl)-3-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]benzamide |
| SMILES | O=C(NCCO)c1cccc(N[C@H]2CCC[C@H](C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H21F3N2O2/c17-16(18,19)12-4-2-6-14(10-12)21-13-5-1-3-11(9-13)15(23)20-7-8-22/h1,3,5,9,12,14,21-22H,2,4,6-8,10H2,(H,20,23)/t12-,14-/m0/s1 |
| InChIKey | IFMVTAGWJINRQM-JSGCOSHPSA-N |
| XLogP | 2.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |