C14H15F3N2 — CID 64757163
3-[[3-(trifluoromethyl)cyclohexyl]amino]benzonitrile (PubChem CID 64757163) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)cyclohexyl]amino]benzonitrile.
| Compound Name | 3-[[3-(trifluoromethyl)cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 64757163 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-[[3-(trifluoromethyl)cyclohexyl]amino]benzonitrile |
| SMILES | N#Cc1cccc(NC2CCCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C14H15F3N2/c15-14(16,17)11-4-2-6-13(8-11)19-12-5-1-3-10(7-12)9-18/h1,3,5,7,11,13,19H,2,4,6,8H2 |
| InChIKey | YKONNZXBDSMMNH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |