C14H16F3N3 — CID 64759996
N-[3-(trifluoromethyl)cyclohexyl]-1H-indazol-5-amine (PubChem CID 64759996) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)cyclohexyl]-1H-indazol-5-amine.
| Compound Name | N-[3-(trifluoromethyl)cyclohexyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 64759996 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[3-(trifluoromethyl)cyclohexyl]-1H-indazol-5-amine |
| SMILES | FC(F)(F)C1CCCC(Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C14H16F3N3/c15-14(16,17)10-2-1-3-11(7-10)19-12-4-5-13-9(6-12)8-18-20-13/h4-6,8,10-11,19H,1-3,7H2,(H,18,20) |
| InChIKey | NJAZFNUDBTZITH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |