C16H23N3 — CID 107448253
N-(3-propan-2-ylcyclohexyl)-1H-indazol-6-amine (PubChem CID 107448253) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(3-propan-2-ylcyclohexyl)-1H-indazol-6-amine.
| Compound Name | N-(3-propan-2-ylcyclohexyl)-1H-indazol-6-amine |
|---|---|
| PubChem CID | 107448253 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-(3-propan-2-ylcyclohexyl)-1H-indazol-6-amine |
| SMILES | CC(C)C1CCCC(Nc2ccc3cn[nH]c3c2)C1 |
| InChI | InChI=1S/C16H23N3/c1-11(2)12-4-3-5-14(8-12)18-15-7-6-13-10-17-19-16(13)9-15/h6-7,9-12,14,18H,3-5,8H2,1-2H3,(H,17,19) |
| InChIKey | DIAFYVIPPAPQPL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |