C15H19N3O2 — CID 43690947
N-(1,4-dioxaspiro[4.5]decan-8-yl)-1H-indazol-5-amine (PubChem CID 43690947) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-1H-indazol-5-amine.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 43690947 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-1H-indazol-5-amine |
| SMILES | c1cc2[nH]ncc2cc1NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H19N3O2/c1-2-14-11(10-16-18-14)9-13(1)17-12-3-5-15(6-4-12)19-7-8-20-15/h1-2,9-10,12,17H,3-8H2,(H,16,18) |
| InChIKey | IXJJZJOZZYORMA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |