C18H18Cl2N4 — CID 57446054
N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine (PubChem CID 57446054) has the molecular formula C18H18Cl2N4 and a molecular weight of 361.28 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 57446054 |
| Molecular Formula | C18H18Cl2N4 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine |
| SMILES | Clc1ccc(CN2CCC(Nc3ccc4[nH]ncc4c3)C2)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N4/c19-16-3-1-12(7-17(16)20)10-24-6-5-15(11-24)22-14-2-4-18-13(8-14)9-21-23-18/h1-4,7-9,15,22H,5-6,10-11H2,(H,21,23) |
| InChIKey | YEQSMZIHQJMAEK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |