C19H21ClN4 — CID 44599070
N-[(3S)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-1H-indazol-5-amine (PubChem CID 44599070) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is N-[(3S)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-1H-indazol-5-amine.
| Compound Name | N-[(3S)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 44599070 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(3S)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-1H-indazol-5-amine |
| SMILES | Clc1ccc(CN2CCC[C@H](Nc3ccc4[nH]ncc4c3)C2)cc1 |
| InChI | InChI=1S/C19H21ClN4/c20-16-5-3-14(4-6-16)12-24-9-1-2-18(13-24)22-17-7-8-19-15(10-17)11-21-23-19/h3-8,10-11,18,22H,1-2,9,12-13H2,(H,21,23)/t18-/m0/s1 |
| InChIKey | JQCWNEXLKSGUJQ-SFHVURJKSA-N |
| XLogP | 4.29 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |