C20H21F3N4 — CID 57446055
N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-indazol-5-amine (PubChem CID 57446055) has the molecular formula C20H21F3N4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-indazol-5-amine.
| Compound Name | N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 57446055 |
| Molecular Formula | C20H21F3N4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]-1H-indazol-5-amine |
| SMILES | FC(F)(F)c1cccc(CN2CCCC(Nc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C20H21F3N4/c21-20(22,23)16-4-1-3-14(9-16)12-27-8-2-5-18(13-27)25-17-6-7-19-15(10-17)11-24-26-19/h1,3-4,6-7,9-11,18,25H,2,5,8,12-13H2,(H,24,26) |
| InChIKey | QOYNRBLJACVNTD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |