C21H22F3N3 — CID 59159006
5-[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methyl]-1H-indazole (PubChem CID 59159006) has the molecular formula C21H22F3N3 and a molecular weight of 373.42 g/mol. Its IUPAC name is 5-[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methyl]-1H-indazole.
| Compound Name | 5-[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methyl]-1H-indazole |
|---|---|
| PubChem CID | 59159006 |
| Molecular Formula | C21H22F3N3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 5-[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methyl]-1H-indazole |
| SMILES | FC(F)(F)c1cccc(CN2CCCC(Cc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C21H22F3N3/c22-21(23,24)19-5-1-3-17(11-19)14-27-8-2-4-16(13-27)9-15-6-7-20-18(10-15)12-25-26-20/h1,3,5-7,10-12,16H,2,4,8-9,13-14H2,(H,25,26) |
| InChIKey | KJWZJDPKSHCNRO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |