C21H25N3S — CID 59159035
5-[[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]methyl]-1H-indazole (PubChem CID 59159035) has the molecular formula C21H25N3S and a molecular weight of 351.52 g/mol. Its IUPAC name is 5-[[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]methyl]-1H-indazole.
| Compound Name | 5-[[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]methyl]-1H-indazole |
|---|---|
| PubChem CID | 59159035 |
| Molecular Formula | C21H25N3S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 5-[[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]methyl]-1H-indazole |
| SMILES | CSc1ccc(CN2CCCC(Cc3ccc4[nH]ncc4c3)C2)cc1 |
| InChI | InChI=1S/C21H25N3S/c1-25-20-7-4-16(5-8-20)14-24-10-2-3-18(15-24)11-17-6-9-21-19(12-17)13-22-23-21/h4-9,12-13,18H,2-3,10-11,14-15H2,1H3,(H,22,23) |
| InChIKey | XURBMOAVKHTIQR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |