C21H26N4 — CID 59159018
[4-[[(3R)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methanamine (PubChem CID 59159018) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is [4-[[(3R)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methanamine.
| Compound Name | [4-[[(3R)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 59159018 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | [4-[[(3R)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methanamine |
| SMILES | NCc1ccc(CN2CCC[C@H](Cc3ccc4[nH]ncc4c3)C2)cc1 |
| InChI | InChI=1S/C21H26N4/c22-12-16-3-5-17(6-4-16)14-25-9-1-2-19(15-25)10-18-7-8-21-20(11-18)13-23-24-21/h3-8,11,13,19H,1-2,9-10,12,14-15,22H2,(H,23,24)/t19-/m1/s1 |
| InChIKey | JEMWDCCPNFBZSH-LJQANCHMSA-N |
| XLogP | 3.48 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |