C20H22ClN3 — CID 59159015
5-[[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole (PubChem CID 59159015) has the molecular formula C20H22ClN3 and a molecular weight of 339.87 g/mol. Its IUPAC name is 5-[[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole.
| Compound Name | 5-[[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole |
|---|---|
| PubChem CID | 59159015 |
| Molecular Formula | C20H22ClN3 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-[[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole |
| SMILES | Clc1ccc(CN2CCC[C@H](Cc3ccc4[nH]ncc4c3)C2)cc1 |
| InChI | InChI=1S/C20H22ClN3/c21-19-6-3-15(4-7-19)13-24-9-1-2-17(14-24)10-16-5-8-20-18(11-16)12-22-23-20/h3-8,11-12,17H,1-2,9-10,13-14H2,(H,22,23)/t17-/m1/s1 |
| InChIKey | CDEPQRNHNKZDNP-QGZVFWFLSA-N |
| XLogP | 4.67 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |