C20H21F2N3 — CID 59159138
5-[[(3R)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole (PubChem CID 59159138) has the molecular formula C20H21F2N3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-[[(3R)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole.
| Compound Name | 5-[[(3R)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole |
|---|---|
| PubChem CID | 59159138 |
| Molecular Formula | C20H21F2N3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-[[(3R)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]methyl]-1H-indazole |
| SMILES | Fc1ccc(CN2CCC[C@H](Cc3ccc4[nH]ncc4c3)C2)cc1F |
| InChI | InChI=1S/C20H21F2N3/c21-18-5-3-16(10-19(18)22)13-25-7-1-2-15(12-25)8-14-4-6-20-17(9-14)11-23-24-20/h3-6,9-11,15H,1-2,7-8,12-13H2,(H,23,24)/t15-/m1/s1 |
| InChIKey | PYRLAXGCKDALJK-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |