C23H28N4O — CID 59159183
N-[[3-[[(3S)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]acetamide (PubChem CID 59159183) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[[3-[[(3S)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[[(3S)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 59159183 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[[3-[[(3S)-3-(1H-indazol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(CN2CCC[C@@H](Cc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C23H28N4O/c1-17(28)24-13-19-4-2-5-20(11-19)15-27-9-3-6-21(16-27)10-18-7-8-23-22(12-18)14-25-26-23/h2,4-5,7-8,11-12,14,21H,3,6,9-10,13,15-16H2,1H3,(H,24,28)(H,25,26)/t21-/m0/s1 |
| InChIKey | FENPVOQLZCBPRG-NRFANRHFSA-N |
| XLogP | 3.65 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |