C15H20BrNO3 — CID 82857353
N-(4-bromo-3-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 82857353) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 82857353 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | COc1cc(NC2CCC3(CC2)OCCO3)ccc1Br |
| InChI | InChI=1S/C15H20BrNO3/c1-18-14-10-12(2-3-13(14)16)17-11-4-6-15(7-5-11)19-8-9-20-15/h2-3,10-11,17H,4-9H2,1H3 |
| InChIKey | NJJDXCDFRITZRL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |