C15H19Br2NO3 — CID 103411779
N-(2,4-dibromo-5-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 103411779) has the molecular formula C15H19Br2NO3 and a molecular weight of 421.13 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 103411779 |
| Molecular Formula | C15H19Br2NO3 |
| Molecular Weight | 421.13 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | COc1cc(NC2CCC3(CC2)OCCO3)c(Br)cc1Br |
| InChI | InChI=1S/C15H19Br2NO3/c1-19-14-9-13(11(16)8-12(14)17)18-10-2-4-15(5-3-10)20-6-7-21-15/h8-10,18H,2-7H2,1H3 |
| InChIKey | DDNCEYYUPFFZAA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.13 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |