C15H22Br2N2O — CID 103411071
N-(2,4-dibromo-5-methoxyphenyl)-1-propylpiperidin-4-amine (PubChem CID 103411071) has the molecular formula C15H22Br2N2O and a molecular weight of 406.16 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-1-propylpiperidin-4-amine.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 103411071 |
| Molecular Formula | C15H22Br2N2O |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(Nc2cc(OC)c(Br)cc2Br)CC1 |
| InChI | InChI=1S/C15H22Br2N2O/c1-3-6-19-7-4-11(5-8-19)18-14-10-15(20-2)13(17)9-12(14)16/h9-11,18H,3-8H2,1-2H3 |
| InChIKey | YNIXIKOOSCNOHY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |