C16H25BrN2 — CID 107572074
N-(4-bromo-3,5-dimethylphenyl)-1-propylpiperidin-4-amine (PubChem CID 107572074) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-1-propylpiperidin-4-amine.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 107572074 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(Nc2cc(C)c(Br)c(C)c2)CC1 |
| InChI | InChI=1S/C16H25BrN2/c1-4-7-19-8-5-14(6-9-19)18-15-10-12(2)16(17)13(3)11-15/h10-11,14,18H,4-9H2,1-3H3 |
| InChIKey | JGWZNEUTLJLJIR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |