C14H19Cl2FN2 — CID 107572762
N-(3,5-dichloro-4-fluorophenyl)-1-propylpiperidin-4-amine (PubChem CID 107572762) has the molecular formula C14H19Cl2FN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-1-propylpiperidin-4-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 107572762 |
| Molecular Formula | C14H19Cl2FN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(Nc2cc(Cl)c(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H19Cl2FN2/c1-2-5-19-6-3-10(4-7-19)18-11-8-12(15)14(17)13(16)9-11/h8-10,18H,2-7H2,1H3 |
| InChIKey | PXNIWGHMAXKAJE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|