C14H22FN3 — CID 54963571
5-fluoro-3-N-(1-propylpiperidin-4-yl)benzene-1,3-diamine (PubChem CID 54963571) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-fluoro-3-N-(1-propylpiperidin-4-yl)benzene-1,3-diamine.
| Compound Name | 5-fluoro-3-N-(1-propylpiperidin-4-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 54963571 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 5-fluoro-3-N-(1-propylpiperidin-4-yl)benzene-1,3-diamine |
| SMILES | CCCN1CCC(Nc2cc(N)cc(F)c2)CC1 |
| InChI | InChI=1S/C14H22FN3/c1-2-5-18-6-3-13(4-7-18)17-14-9-11(15)8-12(16)10-14/h8-10,13,17H,2-7,16H2,1H3 |
| InChIKey | FOTCMNHBLSXKKE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|