C16H28N4 — CID 104533592
3-N-propyl-5-N-(1-propylpiperidin-4-yl)pyridine-3,5-diamine (PubChem CID 104533592) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 3-N-propyl-5-N-(1-propylpiperidin-4-yl)pyridine-3,5-diamine.
| Compound Name | 3-N-propyl-5-N-(1-propylpiperidin-4-yl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104533592 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3-N-propyl-5-N-(1-propylpiperidin-4-yl)pyridine-3,5-diamine |
| SMILES | CCCNc1cncc(NC2CCN(CCC)CC2)c1 |
| InChI | InChI=1S/C16H28N4/c1-3-7-18-15-11-16(13-17-12-15)19-14-5-9-20(8-4-2)10-6-14/h11-14,18-19H,3-10H2,1-2H3 |
| InChIKey | GCGPRWSHWVCUBO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |