C13H21N3O2S — CID 104533086
5-N-(1,1-dioxothian-4-yl)-3-N-propylpyridine-3,5-diamine (PubChem CID 104533086) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-N-(1,1-dioxothian-4-yl)-3-N-propylpyridine-3,5-diamine.
| Compound Name | 5-N-(1,1-dioxothian-4-yl)-3-N-propylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104533086 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-N-(1,1-dioxothian-4-yl)-3-N-propylpyridine-3,5-diamine |
| SMILES | CCCNc1cncc(NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H21N3O2S/c1-2-5-15-12-8-13(10-14-9-12)16-11-3-6-19(17,18)7-4-11/h8-11,15-16H,2-7H2,1H3 |
| InChIKey | NKTJVWBOPVTYNJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |