C11H13F2NO2S — CID 43511555
N-(3,5-difluorophenyl)-1,1-dioxothian-4-amine (PubChem CID 43511555) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(3,5-difluorophenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43511555 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(3,5-difluorophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C11H13F2NO2S/c12-8-5-9(13)7-11(6-8)14-10-1-3-17(15,16)4-2-10/h5-7,10,14H,1-4H2 |
| InChIKey | JBVRPDDRXJCHRC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |